C11H19N3O3S — CID 54973736
N-(5-methyl-1,2-oxazol-3-yl)-2-piperidin-2-ylethanesulfonamide (PubChem CID 54973736) has the molecular formula C11H19N3O3S and a molecular weight of 273.36 g/mol. Its IUPAC name is N-(5-methyl-1,2-oxazol-3-yl)-2-piperidin-2-ylethanesulfonamide.
| Compound Name | N-(5-methyl-1,2-oxazol-3-yl)-2-piperidin-2-ylethanesulfonamide |
|---|---|
| PubChem CID | 54973736 |
| Molecular Formula | C11H19N3O3S |
| Molecular Weight | 273.36 g/mol |
| Exact Mass | 273.11 |
| IUPAC Name | N-(5-methyl-1,2-oxazol-3-yl)-2-piperidin-2-ylethanesulfonamide |
| SMILES | Cc1cc(NS(=O)(=O)CCC2CCCCN2)no1 |
| InChI | InChI=1S/C11H19N3O3S/c1-9-8-11(13-17-9)14-18(15,16)7-5-10-4-2-3-6-12-10/h8,10,12H,2-7H2,1H3,(H,13,14) |
| InChIKey | AJHKUZUZIHGFDS-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 84.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.36 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |