C13H17BrF2N2O2S — CID 65499786
N-(4-bromo-2,6-difluorophenyl)-2-piperidin-2-ylethanesulfonamide (PubChem CID 65499786) has the molecular formula C13H17BrF2N2O2S and a molecular weight of 383.26 g/mol. Its IUPAC name is N-(4-bromo-2,6-difluorophenyl)-2-piperidin-2-ylethanesulfonamide.
| Compound Name | N-(4-bromo-2,6-difluorophenyl)-2-piperidin-2-ylethanesulfonamide |
|---|---|
| PubChem CID | 65499786 |
| Molecular Formula | C13H17BrF2N2O2S |
| Molecular Weight | 383.26 g/mol |
| Exact Mass | 382.02 |
| IUPAC Name | N-(4-bromo-2,6-difluorophenyl)-2-piperidin-2-ylethanesulfonamide |
| SMILES | O=S(=O)(CCC1CCCCN1)Nc1c(F)cc(Br)cc1F |
| InChI | InChI=1S/C13H17BrF2N2O2S/c14-9-7-11(15)13(12(16)8-9)18-21(19,20)6-4-10-3-1-2-5-17-10/h7-8,10,17-18H,1-6H2 |
| InChIKey | BSWOYZBVHZVXSY-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.26 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |