C14H17NO — CID 94859293
(2R)-2-(1-benzofuran-2-ylmethyl)piperidine (PubChem CID 94859293) has the molecular formula C14H17NO and a molecular weight of 215.30 g/mol. Its IUPAC name is (2R)-2-(1-benzofuran-2-ylmethyl)piperidine.
| Compound Name | (2R)-2-(1-benzofuran-2-ylmethyl)piperidine |
|---|---|
| PubChem CID | 94859293 |
| Molecular Formula | C14H17NO |
| Molecular Weight | 215.30 g/mol |
| Exact Mass | 215.13 |
| IUPAC Name | (2R)-2-(1-benzofuran-2-ylmethyl)piperidine |
| SMILES | c1ccc2oc(C[C@H]3CCCCN3)cc2c1 |
| InChI | InChI=1S/C14H17NO/c1-2-7-14-11(5-1)9-13(16-14)10-12-6-3-4-8-15-12/h1-2,5,7,9,12,15H,3-4,6,8,10H2/t12-/m1/s1 |
| InChIKey | BACKVISBRLZYOX-GFCCVEGCSA-N |
| XLogP | 3.12 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.30 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |