About CID 10263377
CID 10263377 (PubChem CID 10263377) has the molecular formula C10H5N2Se
and a molecular weight of 232.12 g/mol.
Molecular Properties
| Compound Name | CID 10263377 |
| PubChem CID | 10263377 |
| Molecular Formula | C10H5N2Se |
| Molecular Weight | 232.12 g/mol |
| Exact Mass | 232.96 |
| IUPAC Name | — |
| SMILES | N#Cc1cc2ccccc2nc1[Se] |
| InChI | InChI=1S/C10H5N2Se/c11-6-8-5-7-3-1-2-4-9(7)12-10(8)13/h1-5H |
| InChIKey | MJPZTENPNADDSG-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.12 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 10263377 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 10263377?
The IUPAC name of CID 10263377 (CID 10263377) is not available.
What is the SMILES notation for CID 10263377?
The canonical SMILES for CID 10263377 is N#Cc1cc2ccccc2nc1[Se].
What is the InChIKey of CID 10263377?
The InChIKey is MJPZTENPNADDSG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H5N2Se/c11-6-8-5-7-3-1-2-4-9(7)12-10(8)13/h1-5H.
What are the key properties of CID 10263377?
CID 10263377 has a molecular weight of 232.12 g/mol, XLogP of 0.90, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 10263377 is sourced from PubChem (CID 10263377), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).