C10H15BrN2OS — CID 102633793
2-[(4-bromo-1,3-thiazol-2-yl)-methylamino]cyclohexan-1-ol (PubChem CID 102633793) has the molecular formula C10H15BrN2OS and a molecular weight of 291.21 g/mol. Its IUPAC name is 2-[(4-bromo-1,3-thiazol-2-yl)-methylamino]cyclohexan-1-ol.
| Compound Name | 2-[(4-bromo-1,3-thiazol-2-yl)-methylamino]cyclohexan-1-ol |
|---|---|
| PubChem CID | 102633793 |
| Molecular Formula | C10H15BrN2OS |
| Molecular Weight | 291.21 g/mol |
| Exact Mass | 290.01 |
| IUPAC Name | 2-[(4-bromo-1,3-thiazol-2-yl)-methylamino]cyclohexan-1-ol |
| SMILES | CN(c1nc(Br)cs1)C1CCCCC1O |
| InChI | InChI=1S/C10H15BrN2OS/c1-13(10-12-9(11)6-15-10)7-4-2-3-5-8(7)14/h6-8,14H,2-5H2,1H3 |
| InChIKey | DPLWBNGFMKZRAU-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.21 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |