C12H16Br2N2O — CID 102635970
2-[(3,5-dibromo-2-pyridinyl)-methylamino]cyclohexan-1-ol (PubChem CID 102635970) has the molecular formula C12H16Br2N2O and a molecular weight of 364.08 g/mol. Its IUPAC name is 2-[(3,5-dibromo-2-pyridinyl)-methylamino]cyclohexan-1-ol.
| Compound Name | 2-[(3,5-dibromo-2-pyridinyl)-methylamino]cyclohexan-1-ol |
|---|---|
| PubChem CID | 102635970 |
| Molecular Formula | C12H16Br2N2O |
| Molecular Weight | 364.08 g/mol |
| Exact Mass | 361.96 |
| IUPAC Name | 2-[(3,5-dibromo-2-pyridinyl)-methylamino]cyclohexan-1-ol |
| SMILES | CN(c1ncc(Br)cc1Br)C1CCCCC1O |
| InChI | InChI=1S/C12H16Br2N2O/c1-16(10-4-2-3-5-11(10)17)12-9(14)6-8(13)7-15-12/h6-7,10-11,17H,2-5H2,1H3 |
| InChIKey | GJFCOFIJXJICNT-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.08 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |