C15H18BrN3O — CID 102635969
2-[(7-bromo-1,5-naphthyridin-4-yl)-methylamino]cyclohexan-1-ol (PubChem CID 102635969) has the molecular formula C15H18BrN3O and a molecular weight of 336.23 g/mol. Its IUPAC name is 2-[(7-bromo-1,5-naphthyridin-4-yl)-methylamino]cyclohexan-1-ol.
| Compound Name | 2-[(7-bromo-1,5-naphthyridin-4-yl)-methylamino]cyclohexan-1-ol |
|---|---|
| PubChem CID | 102635969 |
| Molecular Formula | C15H18BrN3O |
| Molecular Weight | 336.23 g/mol |
| Exact Mass | 335.06 |
| IUPAC Name | 2-[(7-bromo-1,5-naphthyridin-4-yl)-methylamino]cyclohexan-1-ol |
| SMILES | CN(c1ccnc2cc(Br)cnc12)C1CCCCC1O |
| InChI | InChI=1S/C15H18BrN3O/c1-19(12-4-2-3-5-14(12)20)13-6-7-17-11-8-10(16)9-18-15(11)13/h6-9,12,14,20H,2-5H2,1H3 |
| InChIKey | FRTMVCWWWHSTNN-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 49.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.23 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |