C15H27NO — CID 10263565
2-(3,3-dimethyl-2-propan-2-yliminobutyl)cyclohexan-1-one (PubChem CID 10263565) has the molecular formula C15H27NO and a molecular weight of 237.39 g/mol. Its IUPAC name is 2-(3,3-dimethyl-2-propan-2-yliminobutyl)cyclohexan-1-one.
| Compound Name | 2-(3,3-dimethyl-2-propan-2-yliminobutyl)cyclohexan-1-one |
|---|---|
| PubChem CID | 10263565 |
| Molecular Formula | C15H27NO |
| Molecular Weight | 237.39 g/mol |
| Exact Mass | 237.21 |
| IUPAC Name | 2-(3,3-dimethyl-2-propan-2-yliminobutyl)cyclohexan-1-one |
| SMILES | CC(C)/N=C(/CC1CCCCC1=O)C(C)(C)C |
| InChI | InChI=1S/C15H27NO/c1-11(2)16-14(15(3,4)5)10-12-8-6-7-9-13(12)17/h11-12H,6-10H2,1-5H3/b16-14- |
| InChIKey | YLFIUWNTKBKYIT-PEZBUJJGSA-N |
| XLogP | 4.03 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.39 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|