C15H21FN2O3 — CID 102635847
methyl 2-amino-4-fluoro-5-[(2-hydroxycyclohexyl)-methylamino]benzoate (PubChem CID 102635847) has the molecular formula C15H21FN2O3 and a molecular weight of 296.34 g/mol. Its IUPAC name is methyl 2-amino-4-fluoro-5-[(2-hydroxycyclohexyl)-methylamino]benzoate.
| Compound Name | methyl 2-amino-4-fluoro-5-[(2-hydroxycyclohexyl)-methylamino]benzoate |
|---|---|
| PubChem CID | 102635847 |
| Molecular Formula | C15H21FN2O3 |
| Molecular Weight | 296.34 g/mol |
| Exact Mass | 296.15 |
| IUPAC Name | methyl 2-amino-4-fluoro-5-[(2-hydroxycyclohexyl)-methylamino]benzoate |
| SMILES | COC(=O)c1cc(N(C)C2CCCCC2O)c(F)cc1N |
| InChI | InChI=1S/C15H21FN2O3/c1-18(12-5-3-4-6-14(12)19)13-7-9(15(20)21-2)11(17)8-10(13)16/h7-8,12,14,19H,3-6,17H2,1-2H3 |
| InChIKey | BOPQYRRVTYDOFV-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 75.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.34 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|