C14H19FN2O3 — CID 62087029
methyl 2-amino-4-fluoro-5-[(2-methoxycyclopentyl)amino]benzoate (PubChem CID 62087029) has the molecular formula C14H19FN2O3 and a molecular weight of 282.31 g/mol. Its IUPAC name is methyl 2-amino-4-fluoro-5-[(2-methoxycyclopentyl)amino]benzoate.
| Compound Name | methyl 2-amino-4-fluoro-5-[(2-methoxycyclopentyl)amino]benzoate |
|---|---|
| PubChem CID | 62087029 |
| Molecular Formula | C14H19FN2O3 |
| Molecular Weight | 282.31 g/mol |
| Exact Mass | 282.14 |
| IUPAC Name | methyl 2-amino-4-fluoro-5-[(2-methoxycyclopentyl)amino]benzoate |
| SMILES | COC(=O)c1cc(NC2CCCC2OC)c(F)cc1N |
| InChI | InChI=1S/C14H19FN2O3/c1-19-13-5-3-4-11(13)17-12-6-8(14(18)20-2)10(16)7-9(12)15/h6-7,11,13,17H,3-5,16H2,1-2H3 |
| InChIKey | NVEPAIMWGUIOSN-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.31 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|