C13H17N3OS — CID 102635901
2-[methyl(thieno[3,2-d]pyrimidin-4-yl)amino]cyclohexan-1-ol (PubChem CID 102635901) has the molecular formula C13H17N3OS and a molecular weight of 263.37 g/mol. Its IUPAC name is 2-[methyl(thieno[3,2-d]pyrimidin-4-yl)amino]cyclohexan-1-ol.
| Compound Name | 2-[methyl(thieno[3,2-d]pyrimidin-4-yl)amino]cyclohexan-1-ol |
|---|---|
| PubChem CID | 102635901 |
| Molecular Formula | C13H17N3OS |
| Molecular Weight | 263.37 g/mol |
| Exact Mass | 263.11 |
| IUPAC Name | 2-[methyl(thieno[3,2-d]pyrimidin-4-yl)amino]cyclohexan-1-ol |
| SMILES | CN(c1ncnc2ccsc12)C1CCCCC1O |
| InChI | InChI=1S/C13H17N3OS/c1-16(10-4-2-3-5-11(10)17)13-12-9(6-7-18-12)14-8-15-13/h6-8,10-11,17H,2-5H2,1H3 |
| InChIKey | CRTNAMWBOUMICB-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 49.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.37 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |