C15H24BrN3O — CID 102637651
N-(2-bromocyclohexyl)-N,4-dimethyl-6-propan-2-yloxypyrimidin-2-amine (PubChem CID 102637651) has the molecular formula C15H24BrN3O and a molecular weight of 342.28 g/mol. Its IUPAC name is N-(2-bromocyclohexyl)-N,4-dimethyl-6-propan-2-yloxypyrimidin-2-amine.
| Compound Name | N-(2-bromocyclohexyl)-N,4-dimethyl-6-propan-2-yloxypyrimidin-2-amine |
|---|---|
| PubChem CID | 102637651 |
| Molecular Formula | C15H24BrN3O |
| Molecular Weight | 342.28 g/mol |
| Exact Mass | 341.11 |
| IUPAC Name | N-(2-bromocyclohexyl)-N,4-dimethyl-6-propan-2-yloxypyrimidin-2-amine |
| SMILES | Cc1cc(OC(C)C)nc(N(C)C2CCCCC2Br)n1 |
| InChI | InChI=1S/C15H24BrN3O/c1-10(2)20-14-9-11(3)17-15(18-14)19(4)13-8-6-5-7-12(13)16/h9-10,12-13H,5-8H2,1-4H3 |
| InChIKey | HNMORIXFYYUZTJ-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.28 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|