C12H20ClN3O — CID 112635531
N-(2-chloropropyl)-N,4-dimethyl-6-propan-2-yloxypyrimidin-2-amine (PubChem CID 112635531) has the molecular formula C12H20ClN3O and a molecular weight of 257.76 g/mol. Its IUPAC name is N-(2-chloropropyl)-N,4-dimethyl-6-propan-2-yloxypyrimidin-2-amine.
| Compound Name | N-(2-chloropropyl)-N,4-dimethyl-6-propan-2-yloxypyrimidin-2-amine |
|---|---|
| PubChem CID | 112635531 |
| Molecular Formula | C12H20ClN3O |
| Molecular Weight | 257.76 g/mol |
| Exact Mass | 257.13 |
| IUPAC Name | N-(2-chloropropyl)-N,4-dimethyl-6-propan-2-yloxypyrimidin-2-amine |
| SMILES | Cc1cc(OC(C)C)nc(N(C)CC(C)Cl)n1 |
| InChI | InChI=1S/C12H20ClN3O/c1-8(2)17-11-6-10(4)14-12(15-11)16(5)7-9(3)13/h6,8-9H,7H2,1-5H3 |
| InChIKey | BRFHNXRUEQISKY-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.76 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|