C14H23N3O3 — CID 115973715
methyl 2-methyl-3-[methyl-(4-methyl-6-propoxypyrimidin-2-yl)amino]propanoate (PubChem CID 115973715) has the molecular formula C14H23N3O3 and a molecular weight of 281.36 g/mol. Its IUPAC name is methyl 2-methyl-3-[methyl-(4-methyl-6-propoxypyrimidin-2-yl)amino]propanoate.
| Compound Name | methyl 2-methyl-3-[methyl-(4-methyl-6-propoxypyrimidin-2-yl)amino]propanoate |
|---|---|
| PubChem CID | 115973715 |
| Molecular Formula | C14H23N3O3 |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.17 |
| IUPAC Name | methyl 2-methyl-3-[methyl-(4-methyl-6-propoxypyrimidin-2-yl)amino]propanoate |
| SMILES | CCCOc1cc(C)nc(N(C)CC(C)C(=O)OC)n1 |
| InChI | InChI=1S/C14H23N3O3/c1-6-7-20-12-8-11(3)15-14(16-12)17(4)9-10(2)13(18)19-5/h8,10H,6-7,9H2,1-5H3 |
| InChIKey | HOYNXKHHOCXZNT-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 64.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |