C18H30BrNO — CID 102638431
N-(2-bromocyclohexyl)-N-methyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-2-carboxamide (PubChem CID 102638431) has the molecular formula C18H30BrNO and a molecular weight of 356.35 g/mol. Its IUPAC name is N-(2-bromocyclohexyl)-N-methyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-2-carboxamide.
| Compound Name | N-(2-bromocyclohexyl)-N-methyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-2-carboxamide |
|---|---|
| PubChem CID | 102638431 |
| Molecular Formula | C18H30BrNO |
| Molecular Weight | 356.35 g/mol |
| Exact Mass | 355.15 |
| IUPAC Name | N-(2-bromocyclohexyl)-N-methyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-2-carboxamide |
| SMILES | CN(C(=O)C1CCC2CCCCC2C1)C1CCCCC1Br |
| InChI | InChI=1S/C18H30BrNO/c1-20(17-9-5-4-8-16(17)19)18(21)15-11-10-13-6-2-3-7-14(13)12-15/h13-17H,2-12H2,1H3 |
| InChIKey | PFJMEBYTJWJMDM-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.35 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|