About N-(2-bromocyclohexyl)-N,3,3-trimethylbutanamide
N-(2-bromocyclohexyl)-N,3,3-trimethylbutanamide (PubChem CID 102638498) has the molecular formula C13H24BrNO
and a molecular weight of 290.25 g/mol. Its IUPAC name is N-(2-bromocyclohexyl)-N,3,3-trimethylbutanamide.
Molecular Properties
| Compound Name | N-(2-bromocyclohexyl)-N,3,3-trimethylbutanamide |
| PubChem CID | 102638498 |
| Molecular Formula | C13H24BrNO |
| Molecular Weight | 290.25 g/mol |
| Exact Mass | 289.10 |
| IUPAC Name | N-(2-bromocyclohexyl)-N,3,3-trimethylbutanamide |
| SMILES | CN(C(=O)CC(C)(C)C)C1CCCCC1Br |
| InChI | InChI=1S/C13H24BrNO/c1-13(2,3)9-12(16)15(4)11-8-6-5-7-10(11)14/h10-11H,5-9H2,1-4H3 |
| InChIKey | NGPWTKNOLXMTOF-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.25 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze N-(2-bromocyclohexyl)-N,3,3-trimethylbutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-bromocyclohexyl)-N,3,3-trimethylbutanamide?
The IUPAC name of N-(2-bromocyclohexyl)-N,3,3-trimethylbutanamide (CID 102638498) is N-(2-bromocyclohexyl)-N,3,3-trimethylbutanamide.
What is the SMILES notation for N-(2-bromocyclohexyl)-N,3,3-trimethylbutanamide?
The canonical SMILES for N-(2-bromocyclohexyl)-N,3,3-trimethylbutanamide is CN(C(=O)CC(C)(C)C)C1CCCCC1Br.
What is the InChIKey of N-(2-bromocyclohexyl)-N,3,3-trimethylbutanamide?
The InChIKey is NGPWTKNOLXMTOF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H24BrNO/c1-13(2,3)9-12(16)15(4)11-8-6-5-7-10(11)14/h10-11H,5-9H2,1-4H3.
What are the key properties of N-(2-bromocyclohexyl)-N,3,3-trimethylbutanamide?
N-(2-bromocyclohexyl)-N,3,3-trimethylbutanamide has a molecular weight of 290.25 g/mol, XLogP of 3.59, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-bromocyclohexyl)-N,3,3-trimethylbutanamide is sourced from PubChem (CID 102638498), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).