C10H15BrF3NO — CID 102638433
N-(2-bromocyclohexyl)-3,3,3-trifluoro-N-methylpropanamide (PubChem CID 102638433) has the molecular formula C10H15BrF3NO and a molecular weight of 302.13 g/mol. Its IUPAC name is N-(2-bromocyclohexyl)-3,3,3-trifluoro-N-methylpropanamide.
| Compound Name | N-(2-bromocyclohexyl)-3,3,3-trifluoro-N-methylpropanamide |
|---|---|
| PubChem CID | 102638433 |
| Molecular Formula | C10H15BrF3NO |
| Molecular Weight | 302.13 g/mol |
| Exact Mass | 301.03 |
| IUPAC Name | N-(2-bromocyclohexyl)-3,3,3-trifluoro-N-methylpropanamide |
| SMILES | CN(C(=O)CC(F)(F)F)C1CCCCC1Br |
| InChI | InChI=1S/C10H15BrF3NO/c1-15(9(16)6-10(12,13)14)8-5-3-2-4-7(8)11/h7-8H,2-6H2,1H3 |
| InChIKey | IAOXETPALPVQGP-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.13 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|