C11H17BrF3NO — CID 102638469
N-(2-bromocyclohexyl)-4,4,4-trifluoro-N-methylbutanamide (PubChem CID 102638469) has the molecular formula C11H17BrF3NO and a molecular weight of 316.16 g/mol. Its IUPAC name is N-(2-bromocyclohexyl)-4,4,4-trifluoro-N-methylbutanamide.
| Compound Name | N-(2-bromocyclohexyl)-4,4,4-trifluoro-N-methylbutanamide |
|---|---|
| PubChem CID | 102638469 |
| Molecular Formula | C11H17BrF3NO |
| Molecular Weight | 316.16 g/mol |
| Exact Mass | 315.04 |
| IUPAC Name | N-(2-bromocyclohexyl)-4,4,4-trifluoro-N-methylbutanamide |
| SMILES | CN(C(=O)CCC(F)(F)F)C1CCCCC1Br |
| InChI | InChI=1S/C11H17BrF3NO/c1-16(9-5-3-2-4-8(9)12)10(17)6-7-11(13,14)15/h8-9H,2-7H2,1H3 |
| InChIKey | RXASKFZPOPTVDA-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.16 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|