C11H19BrF3N — CID 102637217
2-bromo-N-methyl-N-(4,4,4-trifluorobutyl)cyclohexan-1-amine (PubChem CID 102637217) has the molecular formula C11H19BrF3N and a molecular weight of 302.18 g/mol. Its IUPAC name is 2-bromo-N-methyl-N-(4,4,4-trifluorobutyl)cyclohexan-1-amine.
| Compound Name | 2-bromo-N-methyl-N-(4,4,4-trifluorobutyl)cyclohexan-1-amine |
|---|---|
| PubChem CID | 102637217 |
| Molecular Formula | C11H19BrF3N |
| Molecular Weight | 302.18 g/mol |
| Exact Mass | 301.07 |
| IUPAC Name | 2-bromo-N-methyl-N-(4,4,4-trifluorobutyl)cyclohexan-1-amine |
| SMILES | CN(CCCC(F)(F)F)C1CCCCC1Br |
| InChI | InChI=1S/C11H19BrF3N/c1-16(8-4-7-11(13,14)15)10-6-3-2-5-9(10)12/h9-10H,2-8H2,1H3 |
| InChIKey | MYBMGKXQZNPJOY-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.18 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|