C15H19BrO3 — CID 102639129
ethyl 2-[(3-bromo-4-methoxyphenyl)methyl]-2-methylbut-3-enoate (PubChem CID 102639129) has the molecular formula C15H19BrO3 and a molecular weight of 327.22 g/mol. Its IUPAC name is ethyl 2-[(3-bromo-4-methoxyphenyl)methyl]-2-methylbut-3-enoate.
| Compound Name | ethyl 2-[(3-bromo-4-methoxyphenyl)methyl]-2-methylbut-3-enoate |
|---|---|
| PubChem CID | 102639129 |
| Molecular Formula | C15H19BrO3 |
| Molecular Weight | 327.22 g/mol |
| Exact Mass | 326.05 |
| IUPAC Name | ethyl 2-[(3-bromo-4-methoxyphenyl)methyl]-2-methylbut-3-enoate |
| SMILES | C=CC(C)(Cc1ccc(OC)c(Br)c1)C(=O)OCC |
| InChI | InChI=1S/C15H19BrO3/c1-5-15(3,14(17)19-6-2)10-11-7-8-13(18-4)12(16)9-11/h5,7-9H,1,6,10H2,2-4H3 |
| InChIKey | PVFUJCIWSYGMCE-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.22 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|