C10H21NO2S — CID 102640476
2-ethenyl-N,2-dimethyl-5-methylsulfonylpentan-1-amine (PubChem CID 102640476) has the molecular formula C10H21NO2S and a molecular weight of 219.35 g/mol. Its IUPAC name is 2-ethenyl-N,2-dimethyl-5-methylsulfonylpentan-1-amine.
| Compound Name | 2-ethenyl-N,2-dimethyl-5-methylsulfonylpentan-1-amine |
|---|---|
| PubChem CID | 102640476 |
| Molecular Formula | C10H21NO2S |
| Molecular Weight | 219.35 g/mol |
| Exact Mass | 219.13 |
| IUPAC Name | 2-ethenyl-N,2-dimethyl-5-methylsulfonylpentan-1-amine |
| SMILES | C=CC(C)(CCCS(C)(=O)=O)CNC |
| InChI | InChI=1S/C10H21NO2S/c1-5-10(2,9-11-3)7-6-8-14(4,12)13/h5,11H,1,6-9H2,2-4H3 |
| InChIKey | FUHIPQXZDWYFLV-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.35 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|