C11H23NO2S — CID 102640561
2-ethenyl-5-ethylsulfonyl-N,2-dimethylpentan-1-amine (PubChem CID 102640561) has the molecular formula C11H23NO2S and a molecular weight of 233.38 g/mol. Its IUPAC name is 2-ethenyl-5-ethylsulfonyl-N,2-dimethylpentan-1-amine.
| Compound Name | 2-ethenyl-5-ethylsulfonyl-N,2-dimethylpentan-1-amine |
|---|---|
| PubChem CID | 102640561 |
| Molecular Formula | C11H23NO2S |
| Molecular Weight | 233.38 g/mol |
| Exact Mass | 233.14 |
| IUPAC Name | 2-ethenyl-5-ethylsulfonyl-N,2-dimethylpentan-1-amine |
| SMILES | C=CC(C)(CCCS(=O)(=O)CC)CNC |
| InChI | InChI=1S/C11H23NO2S/c1-5-11(3,10-12-4)8-7-9-15(13,14)6-2/h5,12H,1,6-10H2,2-4H3 |
| InChIKey | HPQKRLGABRKWBW-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.38 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|