C15H21ClFN — CID 102640860
2-[(2-chloro-3-fluorophenyl)methyl]-2-methyl-N-propylbut-3-en-1-amine (PubChem CID 102640860) has the molecular formula C15H21ClFN and a molecular weight of 269.79 g/mol. Its IUPAC name is 2-[(2-chloro-3-fluorophenyl)methyl]-2-methyl-N-propylbut-3-en-1-amine.
| Compound Name | 2-[(2-chloro-3-fluorophenyl)methyl]-2-methyl-N-propylbut-3-en-1-amine |
|---|---|
| PubChem CID | 102640860 |
| Molecular Formula | C15H21ClFN |
| Molecular Weight | 269.79 g/mol |
| Exact Mass | 269.13 |
| IUPAC Name | 2-[(2-chloro-3-fluorophenyl)methyl]-2-methyl-N-propylbut-3-en-1-amine |
| SMILES | C=CC(C)(CNCCC)Cc1cccc(F)c1Cl |
| InChI | InChI=1S/C15H21ClFN/c1-4-9-18-11-15(3,5-2)10-12-7-6-8-13(17)14(12)16/h5-8,18H,2,4,9-11H2,1,3H3 |
| InChIKey | AYLKWHZEVZGMLR-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.79 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|