C17H23NS — CID 102640890
2-(1-benzothiophen-3-ylmethyl)-2-methyl-N-propylbut-3-en-1-amine (PubChem CID 102640890) has the molecular formula C17H23NS and a molecular weight of 273.44 g/mol. Its IUPAC name is 2-(1-benzothiophen-3-ylmethyl)-2-methyl-N-propylbut-3-en-1-amine.
| Compound Name | 2-(1-benzothiophen-3-ylmethyl)-2-methyl-N-propylbut-3-en-1-amine |
|---|---|
| PubChem CID | 102640890 |
| Molecular Formula | C17H23NS |
| Molecular Weight | 273.44 g/mol |
| Exact Mass | 273.16 |
| IUPAC Name | 2-(1-benzothiophen-3-ylmethyl)-2-methyl-N-propylbut-3-en-1-amine |
| SMILES | C=CC(C)(CNCCC)Cc1csc2ccccc12 |
| InChI | InChI=1S/C17H23NS/c1-4-10-18-13-17(3,5-2)11-14-12-19-16-9-7-6-8-15(14)16/h5-9,12,18H,2,4,10-11,13H2,1,3H3 |
| InChIKey | AMTPSEVUJMZTPG-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.44 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|