C16H22ClNS — CID 114148978
N-(1-benzothiophen-3-ylmethyl)-5-chloro-2,2-dimethylpentan-1-amine (PubChem CID 114148978) has the molecular formula C16H22ClNS and a molecular weight of 295.88 g/mol. Its IUPAC name is N-(1-benzothiophen-3-ylmethyl)-5-chloro-2,2-dimethylpentan-1-amine.
| Compound Name | N-(1-benzothiophen-3-ylmethyl)-5-chloro-2,2-dimethylpentan-1-amine |
|---|---|
| PubChem CID | 114148978 |
| Molecular Formula | C16H22ClNS |
| Molecular Weight | 295.88 g/mol |
| Exact Mass | 295.12 |
| IUPAC Name | N-(1-benzothiophen-3-ylmethyl)-5-chloro-2,2-dimethylpentan-1-amine |
| SMILES | CC(C)(CCCCl)CNCc1csc2ccccc12 |
| InChI | InChI=1S/C16H22ClNS/c1-16(2,8-5-9-17)12-18-10-13-11-19-15-7-4-3-6-14(13)15/h3-4,6-7,11,18H,5,8-10,12H2,1-2H3 |
| InChIKey | PVWFENKBOQMZPW-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.88 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|