C15H21NOS — CID 115135498
3-[2-(1-benzothiophen-3-yl)ethylamino]-2,2-dimethylpropan-1-ol (PubChem CID 115135498) has the molecular formula C15H21NOS and a molecular weight of 263.41 g/mol. Its IUPAC name is 3-[2-(1-benzothiophen-3-yl)ethylamino]-2,2-dimethylpropan-1-ol.
| Compound Name | 3-[2-(1-benzothiophen-3-yl)ethylamino]-2,2-dimethylpropan-1-ol |
|---|---|
| PubChem CID | 115135498 |
| Molecular Formula | C15H21NOS |
| Molecular Weight | 263.41 g/mol |
| Exact Mass | 263.13 |
| IUPAC Name | 3-[2-(1-benzothiophen-3-yl)ethylamino]-2,2-dimethylpropan-1-ol |
| SMILES | CC(C)(CO)CNCCc1csc2ccccc12 |
| InChI | InChI=1S/C15H21NOS/c1-15(2,11-17)10-16-8-7-12-9-18-14-6-4-3-5-13(12)14/h3-6,9,16-17H,7-8,10-11H2,1-2H3 |
| InChIKey | LWWJZJLQABQSJO-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.41 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|