C15H22N2S — CID 115251699
N'-[2-(1-benzothiophen-3-yl)ethyl]-2-ethylpropane-1,3-diamine (PubChem CID 115251699) has the molecular formula C15H22N2S and a molecular weight of 262.42 g/mol. Its IUPAC name is N'-[2-(1-benzothiophen-3-yl)ethyl]-2-ethylpropane-1,3-diamine.
| Compound Name | N'-[2-(1-benzothiophen-3-yl)ethyl]-2-ethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 115251699 |
| Molecular Formula | C15H22N2S |
| Molecular Weight | 262.42 g/mol |
| Exact Mass | 262.15 |
| IUPAC Name | N'-[2-(1-benzothiophen-3-yl)ethyl]-2-ethylpropane-1,3-diamine |
| SMILES | CCC(CN)CNCCc1csc2ccccc12 |
| InChI | InChI=1S/C15H22N2S/c1-2-12(9-16)10-17-8-7-13-11-18-15-6-4-3-5-14(13)15/h3-6,11-12,17H,2,7-10,16H2,1H3 |
| InChIKey | HZSHXZXXLIAGAE-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.42 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|