C13H19N3S — CID 115120046
3-N-[2-(1-benzothiophen-3-yl)ethyl]propane-1,2,3-triamine (PubChem CID 115120046) has the molecular formula C13H19N3S and a molecular weight of 249.38 g/mol. Its IUPAC name is 3-N-[2-(1-benzothiophen-3-yl)ethyl]propane-1,2,3-triamine.
| Compound Name | 3-N-[2-(1-benzothiophen-3-yl)ethyl]propane-1,2,3-triamine |
|---|---|
| PubChem CID | 115120046 |
| Molecular Formula | C13H19N3S |
| Molecular Weight | 249.38 g/mol |
| Exact Mass | 249.13 |
| IUPAC Name | 3-N-[2-(1-benzothiophen-3-yl)ethyl]propane-1,2,3-triamine |
| SMILES | NCC(N)CNCCc1csc2ccccc12 |
| InChI | InChI=1S/C13H19N3S/c14-7-11(15)8-16-6-5-10-9-17-13-4-2-1-3-12(10)13/h1-4,9,11,16H,5-8,14-15H2 |
| InChIKey | AZAFTCDXPNHRJJ-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.38 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|