C15H19NS — CID 64505583
4-(1-benzothiophen-3-yl)-1-cyclopropylbutan-1-amine (PubChem CID 64505583) has the molecular formula C15H19NS and a molecular weight of 245.39 g/mol. Its IUPAC name is 4-(1-benzothiophen-3-yl)-1-cyclopropylbutan-1-amine.
| Compound Name | 4-(1-benzothiophen-3-yl)-1-cyclopropylbutan-1-amine |
|---|---|
| PubChem CID | 64505583 |
| Molecular Formula | C15H19NS |
| Molecular Weight | 245.39 g/mol |
| Exact Mass | 245.12 |
| IUPAC Name | 4-(1-benzothiophen-3-yl)-1-cyclopropylbutan-1-amine |
| SMILES | NC(CCCc1csc2ccccc12)C1CC1 |
| InChI | InChI=1S/C15H19NS/c16-14(11-8-9-11)6-3-4-12-10-17-15-7-2-1-5-13(12)15/h1-2,5,7,10-11,14H,3-4,6,8-9,16H2 |
| InChIKey | DXSFROSZPZWRNI-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.39 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |