C17H23NS — CID 65308766
N-[6-(1-benzothiophen-3-yl)hexyl]cyclopropanamine (PubChem CID 65308766) has the molecular formula C17H23NS and a molecular weight of 273.44 g/mol. Its IUPAC name is N-[6-(1-benzothiophen-3-yl)hexyl]cyclopropanamine.
| Compound Name | N-[6-(1-benzothiophen-3-yl)hexyl]cyclopropanamine |
|---|---|
| PubChem CID | 65308766 |
| Molecular Formula | C17H23NS |
| Molecular Weight | 273.44 g/mol |
| Exact Mass | 273.16 |
| IUPAC Name | N-[6-(1-benzothiophen-3-yl)hexyl]cyclopropanamine |
| SMILES | c1ccc2c(CCCCCCNC3CC3)csc2c1 |
| InChI | InChI=1S/C17H23NS/c1(2-6-12-18-15-10-11-15)3-7-14-13-19-17-9-5-4-8-16(14)17/h4-5,8-9,13,15,18H,1-3,6-7,10-12H2 |
| InChIKey | KQEOBGJLRRDJDX-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.44 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|