About CID 119080104
CID 119080104 (PubChem CID 119080104) has the molecular formula C22H19SSi
and a molecular weight of 343.55 g/mol.
Molecular Properties
| Compound Name | CID 119080104 |
| PubChem CID | 119080104 |
| Molecular Formula | C22H19SSi |
| Molecular Weight | 343.55 g/mol |
| Exact Mass | 343.10 |
| IUPAC Name | — |
| SMILES | c1ccc([Si](CCc2csc3ccccc23)c2ccccc2)cc1 |
| InChI | InChI=1S/C22H19SSi/c1-3-9-19(10-4-1)24(20-11-5-2-6-12-20)16-15-18-17-23-22-14-8-7-13-21(18)22/h1-14,17H,15-16H2 |
| InChIKey | OWUSXNPYFZWEOZ-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.55 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 119080104 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 119080104?
The IUPAC name of CID 119080104 (CID 119080104) is not available.
What is the SMILES notation for CID 119080104?
The canonical SMILES for CID 119080104 is c1ccc([Si](CCc2csc3ccccc23)c2ccccc2)cc1.
What is the InChIKey of CID 119080104?
The InChIKey is OWUSXNPYFZWEOZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H19SSi/c1-3-9-19(10-4-1)24(20-11-5-2-6-12-20)16-15-18-17-23-22-14-8-7-13-21(18)22/h1-14,17H,15-16H2.
What are the key properties of CID 119080104?
CID 119080104 has a molecular weight of 343.55 g/mol, XLogP of 4.75, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 119080104 is sourced from PubChem (CID 119080104), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).