C19H27NS — CID 65423179
2-(1-benzothiophen-3-yl)-1-(4-propylcyclohexyl)ethanamine (PubChem CID 65423179) has the molecular formula C19H27NS and a molecular weight of 301.50 g/mol. Its IUPAC name is 2-(1-benzothiophen-3-yl)-1-(4-propylcyclohexyl)ethanamine.
| Compound Name | 2-(1-benzothiophen-3-yl)-1-(4-propylcyclohexyl)ethanamine |
|---|---|
| PubChem CID | 65423179 |
| Molecular Formula | C19H27NS |
| Molecular Weight | 301.50 g/mol |
| Exact Mass | 301.19 |
| IUPAC Name | 2-(1-benzothiophen-3-yl)-1-(4-propylcyclohexyl)ethanamine |
| SMILES | CCCC1CCC(C(N)Cc2csc3ccccc23)CC1 |
| InChI | InChI=1S/C19H27NS/c1-2-5-14-8-10-15(11-9-14)18(20)12-16-13-21-19-7-4-3-6-17(16)19/h3-4,6-7,13-15,18H,2,5,8-12,20H2,1H3 |
| InChIKey | FGYBJTVSJVRTMP-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.50 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |