C13H18N2S — CID 115251280
N'-(1-benzothiophen-3-yl)-2-ethylpropane-1,3-diamine (PubChem CID 115251280) has the molecular formula C13H18N2S and a molecular weight of 234.37 g/mol. Its IUPAC name is N'-(1-benzothiophen-3-yl)-2-ethylpropane-1,3-diamine.
| Compound Name | N'-(1-benzothiophen-3-yl)-2-ethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 115251280 |
| Molecular Formula | C13H18N2S |
| Molecular Weight | 234.37 g/mol |
| Exact Mass | 234.12 |
| IUPAC Name | N'-(1-benzothiophen-3-yl)-2-ethylpropane-1,3-diamine |
| SMILES | CCC(CN)CNc1csc2ccccc12 |
| InChI | InChI=1S/C13H18N2S/c1-2-10(7-14)8-15-12-9-16-13-6-4-3-5-11(12)13/h3-6,9-10,15H,2,7-8,14H2,1H3 |
| InChIKey | YZZXDFWFEKTGRU-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.37 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |