C9H16N2S — CID 115251177
2-ethyl-N'-thiophen-2-ylpropane-1,3-diamine (PubChem CID 115251177) has the molecular formula C9H16N2S and a molecular weight of 184.31 g/mol. Its IUPAC name is 2-ethyl-N'-thiophen-2-ylpropane-1,3-diamine.
| Compound Name | 2-ethyl-N'-thiophen-2-ylpropane-1,3-diamine |
|---|---|
| PubChem CID | 115251177 |
| Molecular Formula | C9H16N2S |
| Molecular Weight | 184.31 g/mol |
| Exact Mass | 184.10 |
| IUPAC Name | 2-ethyl-N'-thiophen-2-ylpropane-1,3-diamine |
| SMILES | CCC(CN)CNc1cccs1 |
| InChI | InChI=1S/C9H16N2S/c1-2-8(6-10)7-11-9-4-3-5-12-9/h3-5,8,11H,2,6-7,10H2,1H3 |
| InChIKey | XQCKQMMUOVRLRH-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.31 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |