C14H17NO2S — CID 115220236
4-(1-benzothiophen-3-ylamino)-3,3-dimethylbutanoic acid (PubChem CID 115220236) has the molecular formula C14H17NO2S and a molecular weight of 263.36 g/mol. Its IUPAC name is 4-(1-benzothiophen-3-ylamino)-3,3-dimethylbutanoic acid.
| Compound Name | 4-(1-benzothiophen-3-ylamino)-3,3-dimethylbutanoic acid |
|---|---|
| PubChem CID | 115220236 |
| Molecular Formula | C14H17NO2S |
| Molecular Weight | 263.36 g/mol |
| Exact Mass | 263.10 |
| IUPAC Name | 4-(1-benzothiophen-3-ylamino)-3,3-dimethylbutanoic acid |
| SMILES | CC(C)(CNc1csc2ccccc12)CC(=O)O |
| InChI | InChI=1S/C14H17NO2S/c1-14(2,7-13(16)17)9-15-11-8-18-12-6-4-3-5-10(11)12/h3-6,8,15H,7,9H2,1-2H3,(H,16,17) |
| InChIKey | WQQBTCJTNSBWQS-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.36 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |