C13H14O2S2 — CID 116853067
3-(1-benzothiophen-3-ylsulfanyl)-2,2-dimethylpropanoic acid (PubChem CID 116853067) has the molecular formula C13H14O2S2 and a molecular weight of 266.39 g/mol. Its IUPAC name is 3-(1-benzothiophen-3-ylsulfanyl)-2,2-dimethylpropanoic acid.
| Compound Name | 3-(1-benzothiophen-3-ylsulfanyl)-2,2-dimethylpropanoic acid |
|---|---|
| PubChem CID | 116853067 |
| Molecular Formula | C13H14O2S2 |
| Molecular Weight | 266.39 g/mol |
| Exact Mass | 266.04 |
| IUPAC Name | 3-(1-benzothiophen-3-ylsulfanyl)-2,2-dimethylpropanoic acid |
| SMILES | CC(C)(CSc1csc2ccccc12)C(=O)O |
| InChI | InChI=1S/C13H14O2S2/c1-13(2,12(14)15)8-17-11-7-16-10-6-4-3-5-9(10)11/h3-7H,8H2,1-2H3,(H,14,15) |
| InChIKey | ZQUITBUTFZLUSD-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.39 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |