C14H14F2O2S — CID 65297334
4-(1-benzothiophen-3-yl)-4,4-difluoro-2,2-dimethylbutanoic acid (PubChem CID 65297334) has the molecular formula C14H14F2O2S and a molecular weight of 284.33 g/mol. Its IUPAC name is 4-(1-benzothiophen-3-yl)-4,4-difluoro-2,2-dimethylbutanoic acid.
| Compound Name | 4-(1-benzothiophen-3-yl)-4,4-difluoro-2,2-dimethylbutanoic acid |
|---|---|
| PubChem CID | 65297334 |
| Molecular Formula | C14H14F2O2S |
| Molecular Weight | 284.33 g/mol |
| Exact Mass | 284.07 |
| IUPAC Name | 4-(1-benzothiophen-3-yl)-4,4-difluoro-2,2-dimethylbutanoic acid |
| SMILES | CC(C)(CC(F)(F)c1csc2ccccc12)C(=O)O |
| InChI | InChI=1S/C14H14F2O2S/c1-13(2,12(17)18)8-14(15,16)10-7-19-11-6-4-3-5-9(10)11/h3-7H,8H2,1-2H3,(H,17,18) |
| InChIKey | RJYFNYAAFXLJER-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.33 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |