4-(1-benzothiophen-3-yl)-4,4-difluoro-2,2-dimethylbutanoic acid

C14H14F2O2S — CID 65297334

IUPAC4-(1-benzothiophen-3-yl)-4,4-difluoro-2,2-dimethylbutanoic acid
SMILESCC(C)(CC(F)(F)c1csc2ccccc12)C(=O)O
InChIInChI=1S/C14H14F2O2S/c1-13(2,12(17)18)8-14(15,16)10-7-19-11-6-4-3-5-9(10)11/h3-7H,8H2,1-2H3,(H,17,18)
InChIKeyRJYFNYAAFXLJER-UHFFFAOYSA-N
MW284.33 g/mol
LogP4.49
Rot. Bonds4

About 4-(1-benzothiophen-3-yl)-4,4-difluoro-2,2-dimethylbutanoic acid

4-(1-benzothiophen-3-yl)-4,4-difluoro-2,2-dimethylbutanoic acid (PubChem CID 65297334) has the molecular formula C14H14F2O2S and a molecular weight of 284.33 g/mol. Its IUPAC name is 4-(1-benzothiophen-3-yl)-4,4-difluoro-2,2-dimethylbutanoic acid.

Molecular Properties

Compound Name4-(1-benzothiophen-3-yl)-4,4-difluoro-2,2-dimethylbutanoic acid
PubChem CID65297334
Molecular FormulaC14H14F2O2S
Molecular Weight284.33 g/mol
Exact Mass284.07
IUPAC Name4-(1-benzothiophen-3-yl)-4,4-difluoro-2,2-dimethylbutanoic acid
SMILESCC(C)(CC(F)(F)c1csc2ccccc12)C(=O)O
InChIInChI=1S/C14H14F2O2S/c1-13(2,12(17)18)8-14(15,16)10-7-19-11-6-4-3-5-9(10)11/h3-7H,8H2,1-2H3,(H,17,18)
InChIKeyRJYFNYAAFXLJER-UHFFFAOYSA-N
XLogP4.49
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500284.33
LogP ≤ 54.49
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 4-(1-benzothiophen-3-yl)-4,4-difluoro-2,2-dimethylbutanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(1-benzothiophen-3-yl)-4,4-difluoro-2,2-dimethylbutanoic acid?
The IUPAC name of 4-(1-benzothiophen-3-yl)-4,4-difluoro-2,2-dimethylbutanoic acid (CID 65297334) is 4-(1-benzothiophen-3-yl)-4,4-difluoro-2,2-dimethylbutanoic acid.
What is the SMILES notation for 4-(1-benzothiophen-3-yl)-4,4-difluoro-2,2-dimethylbutanoic acid?
The canonical SMILES for 4-(1-benzothiophen-3-yl)-4,4-difluoro-2,2-dimethylbutanoic acid is CC(C)(CC(F)(F)c1csc2ccccc12)C(=O)O.
What is the InChIKey of 4-(1-benzothiophen-3-yl)-4,4-difluoro-2,2-dimethylbutanoic acid?
The InChIKey is RJYFNYAAFXLJER-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14F2O2S/c1-13(2,12(17)18)8-14(15,16)10-7-19-11-6-4-3-5-9(10)11/h3-7H,8H2,1-2H3,(H,17,18).
What are the key properties of 4-(1-benzothiophen-3-yl)-4,4-difluoro-2,2-dimethylbutanoic acid?
4-(1-benzothiophen-3-yl)-4,4-difluoro-2,2-dimethylbutanoic acid has a molecular weight of 284.33 g/mol, XLogP of 4.49, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1-benzothiophen-3-yl)-4,4-difluoro-2,2-dimethylbutanoic acid is sourced from PubChem (CID 65297334), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).