C10H5F5S — CID 102259233
3-(1,1,2,2,2-pentafluoroethyl)-1-benzothiophene (PubChem CID 102259233) has the molecular formula C10H5F5S and a molecular weight of 252.21 g/mol. Its IUPAC name is 3-(1,1,2,2,2-pentafluoroethyl)-1-benzothiophene.
| Compound Name | 3-(1,1,2,2,2-pentafluoroethyl)-1-benzothiophene |
|---|---|
| PubChem CID | 102259233 |
| Molecular Formula | C10H5F5S |
| Molecular Weight | 252.21 g/mol |
| Exact Mass | 252.00 |
| IUPAC Name | 3-(1,1,2,2,2-pentafluoroethyl)-1-benzothiophene |
| SMILES | FC(F)(F)C(F)(F)c1csc2ccccc12 |
| InChI | InChI=1S/C10H5F5S/c11-9(12,10(13,14)15)7-5-16-8-4-2-1-3-6(7)8/h1-5H |
| InChIKey | VNGVNFMUKXFKQP-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.21 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|