C11H11F2NS — CID 116839342
1-(1-benzothiophen-3-yl)-1,1-difluoropropan-2-amine (PubChem CID 116839342) has the molecular formula C11H11F2NS and a molecular weight of 227.28 g/mol. Its IUPAC name is 1-(1-benzothiophen-3-yl)-1,1-difluoropropan-2-amine.
| Compound Name | 1-(1-benzothiophen-3-yl)-1,1-difluoropropan-2-amine |
|---|---|
| PubChem CID | 116839342 |
| Molecular Formula | C11H11F2NS |
| Molecular Weight | 227.28 g/mol |
| Exact Mass | 227.06 |
| IUPAC Name | 1-(1-benzothiophen-3-yl)-1,1-difluoropropan-2-amine |
| SMILES | CC(N)C(F)(F)c1csc2ccccc12 |
| InChI | InChI=1S/C11H11F2NS/c1-7(14)11(12,13)9-6-15-10-5-3-2-4-8(9)10/h2-7H,14H2,1H3 |
| InChIKey | OTJBUDKWRNNEAO-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.28 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |