C12H12F2S — CID 116841490
3-(1,1-difluoro-2-methylpropyl)-1-benzothiophene (PubChem CID 116841490) has the molecular formula C12H12F2S and a molecular weight of 226.29 g/mol. Its IUPAC name is 3-(1,1-difluoro-2-methylpropyl)-1-benzothiophene.
| Compound Name | 3-(1,1-difluoro-2-methylpropyl)-1-benzothiophene |
|---|---|
| PubChem CID | 116841490 |
| Molecular Formula | C12H12F2S |
| Molecular Weight | 226.29 g/mol |
| Exact Mass | 226.06 |
| IUPAC Name | 3-(1,1-difluoro-2-methylpropyl)-1-benzothiophene |
| SMILES | CC(C)C(F)(F)c1csc2ccccc12 |
| InChI | InChI=1S/C12H12F2S/c1-8(2)12(13,14)10-7-15-11-6-4-3-5-9(10)11/h3-8H,1-2H3 |
| InChIKey | ZRXYSVQYMAJMFU-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.29 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |