C15H16O4S — CID 44556579
5-(3-hydroxy-1-benzothiophen-2-yl)-3,3-dimethyl-5-oxopentanoic acid (PubChem CID 44556579) has the molecular formula C15H16O4S and a molecular weight of 292.36 g/mol. Its IUPAC name is 5-(3-hydroxy-1-benzothiophen-2-yl)-3,3-dimethyl-5-oxopentanoic acid.
| Compound Name | 5-(3-hydroxy-1-benzothiophen-2-yl)-3,3-dimethyl-5-oxopentanoic acid |
|---|---|
| PubChem CID | 44556579 |
| Molecular Formula | C15H16O4S |
| Molecular Weight | 292.36 g/mol |
| Exact Mass | 292.08 |
| IUPAC Name | 5-(3-hydroxy-1-benzothiophen-2-yl)-3,3-dimethyl-5-oxopentanoic acid |
| SMILES | CC(C)(CC(=O)O)CC(=O)c1sc2ccccc2c1O |
| InChI | InChI=1S/C15H16O4S/c1-15(2,8-12(17)18)7-10(16)14-13(19)9-5-3-4-6-11(9)20-14/h3-6,19H,7-8H2,1-2H3,(H,17,18) |
| InChIKey | UYNGNDVFMOYLKA-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.36 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiophene_hydroxy(28)', 'substructure': 'N/A'} |
|---|