About 3-hydroxy-1-benzothiophene-2-carboxylic acid;methyl 2-sulfanylbenzoate
3-hydroxy-1-benzothiophene-2-carboxylic acid;methyl 2-sulfanylbenzoate (PubChem CID 159047160) has the molecular formula C17H14O5S2
and a molecular weight of 362.43 g/mol. Its IUPAC name is 3-hydroxy-1-benzothiophene-2-carboxylic acid;methyl 2-sulfanylbenzoate.
Molecular Properties
| Compound Name | 3-hydroxy-1-benzothiophene-2-carboxylic acid;methyl 2-sulfanylbenzoate |
| PubChem CID | 159047160 |
| Molecular Formula | C17H14O5S2 |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.03 |
| IUPAC Name | 3-hydroxy-1-benzothiophene-2-carboxylic acid;methyl 2-sulfanylbenzoate |
| SMILES | COC(=O)c1ccccc1S.O=C(O)c1sc2ccccc2c1O |
| InChI | InChI=1S/C9H6O3S.C8H8O2S/c10-7-5-3-1-2-4-6(5)13-8(7)9(11)12;1-10-8(9)6-4-2-3-5-7(6)11/h1-4,10H,(H,11,12);2-5,11H,1H3 |
| InChIKey | JWULKIBMOISNFG-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiophene_hydroxy(28)', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 3-hydroxy-1-benzothiophene-2-carboxylic acid;methyl 2-sulfanylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-hydroxy-1-benzothiophene-2-carboxylic acid;methyl 2-sulfanylbenzoate?
The IUPAC name of 3-hydroxy-1-benzothiophene-2-carboxylic acid;methyl 2-sulfanylbenzoate (CID 159047160) is 3-hydroxy-1-benzothiophene-2-carboxylic acid;methyl 2-sulfanylbenzoate.
What is the SMILES notation for 3-hydroxy-1-benzothiophene-2-carboxylic acid;methyl 2-sulfanylbenzoate?
The canonical SMILES for 3-hydroxy-1-benzothiophene-2-carboxylic acid;methyl 2-sulfanylbenzoate is COC(=O)c1ccccc1S.O=C(O)c1sc2ccccc2c1O.
What is the InChIKey of 3-hydroxy-1-benzothiophene-2-carboxylic acid;methyl 2-sulfanylbenzoate?
The InChIKey is JWULKIBMOISNFG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6O3S.C8H8O2S/c10-7-5-3-1-2-4-6(5)13-8(7)9(11)12;1-10-8(9)6-4-2-3-5-7(6)11/h1-4,10H,(H,11,12);2-5,11H,1H3.
What are the key properties of 3-hydroxy-1-benzothiophene-2-carboxylic acid;methyl 2-sulfanylbenzoate?
3-hydroxy-1-benzothiophene-2-carboxylic acid;methyl 2-sulfanylbenzoate has a molecular weight of 362.43 g/mol, XLogP of 4.07, 2 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hydroxy-1-benzothiophene-2-carboxylic acid;methyl 2-sulfanylbenzoate is sourced from PubChem (CID 159047160), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).