C31H28O3S — CID 139044892
(2S,5S)-2,5-diethyl-2-[2-(3-hydroxy-1-benzothiophen-2-yl)-2-oxoethyl]-3,4-diphenylcyclopent-3-en-1-one (PubChem CID 139044892) has the molecular formula C31H28O3S and a molecular weight of 480.63 g/mol. Its IUPAC name is (2S,5S)-2,5-diethyl-2-[2-(3-hydroxy-1-benzothiophen-2-yl)-2-oxoethyl]-3,4-diphenylcyclopent-3-en-1-one.
| Compound Name | (2S,5S)-2,5-diethyl-2-[2-(3-hydroxy-1-benzothiophen-2-yl)-2-oxoethyl]-3,4-diphenylcyclopent-3-en-1-one |
|---|---|
| PubChem CID | 139044892 |
| Molecular Formula | C31H28O3S |
| Molecular Weight | 480.63 g/mol |
| Exact Mass | 480.18 |
| IUPAC Name | (2S,5S)-2,5-diethyl-2-[2-(3-hydroxy-1-benzothiophen-2-yl)-2-oxoethyl]-3,4-diphenylcyclopent-3-en-1-one |
| SMILES | CC[C@@H]1C(=O)[C@@](CC)(CC(=O)c2sc3ccccc3c2O)C(c2ccccc2)=C1c1ccccc1 |
| InChI | InChI=1S/C31H28O3S/c1-3-22-26(20-13-7-5-8-14-20)27(21-15-9-6-10-16-21)31(4-2,30(22)34)19-24(32)29-28(33)23-17-11-12-18-25(23)35-29/h5-18,22,33H,3-4,19H2,1-2H3/t22-,31-/m0/s1 |
| InChIKey | HSJLSSDWGATCJB-UGDMGKLASA-N |
| XLogP | 7.80 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.63 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiophene_hydroxy(28)', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|