About 9-fluorocinnolino[4,3-b]quinoxaline
9-fluorocinnolino[4,3-b]quinoxaline (PubChem CID 10264104) has the molecular formula C14H7FN4
and a molecular weight of 250.24 g/mol. Its IUPAC name is 9-fluorocinnolino[4,3-b]quinoxaline.
Molecular Properties
| Compound Name | 9-fluorocinnolino[4,3-b]quinoxaline |
| PubChem CID | 10264104 |
| Molecular Formula | C14H7FN4 |
| Molecular Weight | 250.24 g/mol |
| Exact Mass | 250.07 |
| IUPAC Name | 9-fluorocinnolino[4,3-b]quinoxaline |
| SMILES | Fc1ccc2nc3c(nnc4ccccc43)nc2c1 |
| InChI | InChI=1S/C14H7FN4/c15-8-5-6-11-12(7-8)17-14-13(16-11)9-3-1-2-4-10(9)18-19-14/h1-7H |
| InChIKey | MQKAQCILYZXYLI-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.24 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 9-fluorocinnolino[4,3-b]quinoxaline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-fluorocinnolino[4,3-b]quinoxaline?
The IUPAC name of 9-fluorocinnolino[4,3-b]quinoxaline (CID 10264104) is 9-fluorocinnolino[4,3-b]quinoxaline.
What is the SMILES notation for 9-fluorocinnolino[4,3-b]quinoxaline?
The canonical SMILES for 9-fluorocinnolino[4,3-b]quinoxaline is Fc1ccc2nc3c(nnc4ccccc43)nc2c1.
What is the InChIKey of 9-fluorocinnolino[4,3-b]quinoxaline?
The InChIKey is MQKAQCILYZXYLI-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H7FN4/c15-8-5-6-11-12(7-8)17-14-13(16-11)9-3-1-2-4-10(9)18-19-14/h1-7H.
What are the key properties of 9-fluorocinnolino[4,3-b]quinoxaline?
9-fluorocinnolino[4,3-b]quinoxaline has a molecular weight of 250.24 g/mol, XLogP of 2.87, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 9-fluorocinnolino[4,3-b]quinoxaline is sourced from PubChem (CID 10264104), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).