C18H30N2O — CID 102641299
N-tert-butyl-2-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methyl]-2-methylbut-3-en-1-amine (PubChem CID 102641299) has the molecular formula C18H30N2O and a molecular weight of 290.45 g/mol. Its IUPAC name is N-tert-butyl-2-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methyl]-2-methylbut-3-en-1-amine.
| Compound Name | N-tert-butyl-2-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methyl]-2-methylbut-3-en-1-amine |
|---|---|
| PubChem CID | 102641299 |
| Molecular Formula | C18H30N2O |
| Molecular Weight | 290.45 g/mol |
| Exact Mass | 290.24 |
| IUPAC Name | N-tert-butyl-2-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methyl]-2-methylbut-3-en-1-amine |
| SMILES | C=CC(C)(CNC(C)(C)C)Cc1ncc(C)c(OC)c1C |
| InChI | InChI=1S/C18H30N2O/c1-9-18(7,12-20-17(4,5)6)10-15-14(3)16(21-8)13(2)11-19-15/h9,11,20H,1,10,12H2,2-8H3 |
| InChIKey | SPHGWEASUNLKAO-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.45 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|