C13H10N4O2S — CID 102642545
5-phenyl-1-(1,3-thiazol-4-ylmethyl)triazole-4-carboxylic acid (PubChem CID 102642545) has the molecular formula C13H10N4O2S and a molecular weight of 286.32 g/mol. Its IUPAC name is 5-phenyl-1-(1,3-thiazol-4-ylmethyl)triazole-4-carboxylic acid.
| Compound Name | 5-phenyl-1-(1,3-thiazol-4-ylmethyl)triazole-4-carboxylic acid |
|---|---|
| PubChem CID | 102642545 |
| Molecular Formula | C13H10N4O2S |
| Molecular Weight | 286.32 g/mol |
| Exact Mass | 286.05 |
| IUPAC Name | 5-phenyl-1-(1,3-thiazol-4-ylmethyl)triazole-4-carboxylic acid |
| SMILES | O=C(O)c1nnn(Cc2cscn2)c1-c1ccccc1 |
| InChI | InChI=1S/C13H10N4O2S/c18-13(19)11-12(9-4-2-1-3-5-9)17(16-15-11)6-10-7-20-8-14-10/h1-5,7-8H,6H2,(H,18,19) |
| InChIKey | RIMRVTXFQNBOIY-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.32 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |