C13H16N4O3 — CID 102643024
5-(4-aminophenyl)-1-(3-hydroxybutyl)triazole-4-carboxylic acid (PubChem CID 102643024) has the molecular formula C13H16N4O3 and a molecular weight of 276.30 g/mol. Its IUPAC name is 5-(4-aminophenyl)-1-(3-hydroxybutyl)triazole-4-carboxylic acid.
| Compound Name | 5-(4-aminophenyl)-1-(3-hydroxybutyl)triazole-4-carboxylic acid |
|---|---|
| PubChem CID | 102643024 |
| Molecular Formula | C13H16N4O3 |
| Molecular Weight | 276.30 g/mol |
| Exact Mass | 276.12 |
| IUPAC Name | 5-(4-aminophenyl)-1-(3-hydroxybutyl)triazole-4-carboxylic acid |
| SMILES | CC(O)CCn1nnc(C(=O)O)c1-c1ccc(N)cc1 |
| InChI | InChI=1S/C13H16N4O3/c1-8(18)6-7-17-12(11(13(19)20)15-16-17)9-2-4-10(14)5-3-9/h2-5,8,18H,6-7,14H2,1H3,(H,19,20) |
| InChIKey | RVXDASUFCXVGAV-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 114.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.30 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|