C23H17N3O5 — CID 1026436
4-[[[1,3-dioxo-2-(pyridin-3-ylmethyl)isoindole-5-carbonyl]amino]methyl]benzoic acid (PubChem CID 1026436) has the molecular formula C23H17N3O5 and a molecular weight of 415.41 g/mol. Its IUPAC name is 4-[[[1,3-dioxo-2-(pyridin-3-ylmethyl)isoindole-5-carbonyl]amino]methyl]benzoic acid.
| Compound Name | 4-[[[1,3-dioxo-2-(pyridin-3-ylmethyl)isoindole-5-carbonyl]amino]methyl]benzoic acid |
|---|---|
| PubChem CID | 1026436 |
| Molecular Formula | C23H17N3O5 |
| Molecular Weight | 415.41 g/mol |
| Exact Mass | 415.12 |
| IUPAC Name | 4-[[[1,3-dioxo-2-(pyridin-3-ylmethyl)isoindole-5-carbonyl]amino]methyl]benzoic acid |
| SMILES | O=C(O)c1ccc(CNC(=O)c2ccc3c(c2)C(=O)N(Cc2cccnc2)C3=O)cc1 |
| InChI | InChI=1S/C23H17N3O5/c27-20(25-12-14-3-5-16(6-4-14)23(30)31)17-7-8-18-19(10-17)22(29)26(21(18)28)13-15-2-1-9-24-11-15/h1-11H,12-13H2,(H,25,27)(H,30,31) |
| InChIKey | DEVAEKPQMVOUNY-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 116.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.41 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|