C12H13N5O3 — CID 102644259
1-[2-(dimethylamino)-2-oxoethyl]-5-pyridin-2-yltriazole-4-carboxylic acid (PubChem CID 102644259) has the molecular formula C12H13N5O3 and a molecular weight of 275.27 g/mol. Its IUPAC name is 1-[2-(dimethylamino)-2-oxoethyl]-5-pyridin-2-yltriazole-4-carboxylic acid.
| Compound Name | 1-[2-(dimethylamino)-2-oxoethyl]-5-pyridin-2-yltriazole-4-carboxylic acid |
|---|---|
| PubChem CID | 102644259 |
| Molecular Formula | C12H13N5O3 |
| Molecular Weight | 275.27 g/mol |
| Exact Mass | 275.10 |
| IUPAC Name | 1-[2-(dimethylamino)-2-oxoethyl]-5-pyridin-2-yltriazole-4-carboxylic acid |
| SMILES | CN(C)C(=O)Cn1nnc(C(=O)O)c1-c1ccccn1 |
| InChI | InChI=1S/C12H13N5O3/c1-16(2)9(18)7-17-11(8-5-3-4-6-13-8)10(12(19)20)14-15-17/h3-6H,7H2,1-2H3,(H,19,20) |
| InChIKey | MAANTRLIPDDRAO-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 101.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.27 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |