C16H11F3N4O2 — CID 53366342
5-pyridin-2-yl-1-[[3-(trifluoromethyl)phenyl]methyl]triazole-4-carboxylic acid (PubChem CID 53366342) has the molecular formula C16H11F3N4O2 and a molecular weight of 348.28 g/mol. Its IUPAC name is 5-pyridin-2-yl-1-[[3-(trifluoromethyl)phenyl]methyl]triazole-4-carboxylic acid.
| Compound Name | 5-pyridin-2-yl-1-[[3-(trifluoromethyl)phenyl]methyl]triazole-4-carboxylic acid |
|---|---|
| PubChem CID | 53366342 |
| Molecular Formula | C16H11F3N4O2 |
| Molecular Weight | 348.28 g/mol |
| Exact Mass | 348.08 |
| IUPAC Name | 5-pyridin-2-yl-1-[[3-(trifluoromethyl)phenyl]methyl]triazole-4-carboxylic acid |
| SMILES | O=C(O)c1nnn(Cc2cccc(C(F)(F)F)c2)c1-c1ccccn1 |
| InChI | InChI=1S/C16H11F3N4O2/c17-16(18,19)11-5-3-4-10(8-11)9-23-14(12-6-1-2-7-20-12)13(15(24)25)21-22-23/h1-8H,9H2,(H,24,25) |
| InChIKey | ZAVYIPNFALUXPZ-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.28 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |